2-Bromo-4-ethylpyridine
Catalog No: FT-0640253
CAS No: 54453-91-7
- Chemical Name: 2-Bromo-4-ethylpyridine
- Molecular Formula: C7H8BrN
- Molecular Weight: 186.05
- InChI Key: JMDIWBIWPAAWHP-UHFFFAOYSA-N
- InChI: InChI=1S/C7H8BrN/c1-2-6-3-4-9-7(8)5-6/h3-5H,2H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 186.04900 |
| Density: | 1.413g/cm3 |
| CAS: | 54453-91-7 |
| Bolling_Point: | 239.5ºC at 760 mmHg |
| Product_Name: | 2-Bromo-4-ethylpyridine |
| Melting_Point: | 192-194 °C |
| Flash_Point: | 98.6ºC |
| MF: | C7H8BrN |
| Density: | 1.413g/cm3 |
|---|---|
| Computational_Chemistry: | ['1. XlogP :27 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 129 ', '7. Heavy Atom Count :9 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :85 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| LogP: | 2.40650 |
| Flash_Point: | 98.6ºC |
| Melting_Point: | 192-194 °C |
| FW: | 186.04900 |
| PSA: | 12.89000 |
| Exact_Mass: | 184.98400 |
| MF: | C7H8BrN |
| Bolling_Point: | 239.5ºC at 760 mmHg |
| Refractive_Index: | 1.544 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P280-P301 + P312 + P330-P304 + P340 + P312-P305 + P351 + P338 + P310 |
| Risk_Statements(EU): | 36/37/38 |
| Safety_Statements: | S26-S36 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)